C38H40F2N8O3 — CID 159185144
1-(2-fluoro-4-pyridinyl)pyrazol-3-amine;N-[1-(2-fluoro-4-pyridinyl)pyrazol-3-yl]-2-phenylpentanamide;2-phenylpentanoic acid (PubChem CID 159185144) has the molecular formula C38H40F2N8O3 and a molecular weight of 694.79 g/mol. Its IUPAC name is 1-(2-fluoro-4-pyridinyl)pyrazol-3-amine;N-[1-(2-fluoro-4-pyridinyl)pyrazol-3-yl]-2-phenylpentanamide;2-phenylpentanoic acid.
| Compound Name | 1-(2-fluoro-4-pyridinyl)pyrazol-3-amine;N-[1-(2-fluoro-4-pyridinyl)pyrazol-3-yl]-2-phenylpentanamide;2-phenylpentanoic acid |
|---|---|
| PubChem CID | 159185144 |
| Molecular Formula | C38H40F2N8O3 |
| Molecular Weight | 694.79 g/mol |
| Exact Mass | 694.32 |
| IUPAC Name | 1-(2-fluoro-4-pyridinyl)pyrazol-3-amine;N-[1-(2-fluoro-4-pyridinyl)pyrazol-3-yl]-2-phenylpentanamide;2-phenylpentanoic acid |
| SMILES | CCCC(C(=O)Nc1ccn(-c2ccnc(F)c2)n1)c1ccccc1.CCCC(C(=O)O)c1ccccc1.Nc1ccn(-c2ccnc(F)c2)n1 |
| InChI | InChI=1S/C19H19FN4O.C11H14O2.C8H7FN4/c1-2-6-16(14-7-4-3-5-8-14)19(25)22-18-10-12-24(23-18)15-9-11-21-17(20)13-15;1-2-6-10(11(12)13)9-7-4-3-5-8-9;9-7-5-6(1-3-11-7)13-4-2-8(10)12-13/h3-5,7-13,16H,2,6H2,1H3,(H,22,23,25);3-5,7-8,10H,2,6H2,1H3,(H,12,13);1-5H,(H2,10,12) |
| InChIKey | KNJWAGOXLCAFGK-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 153.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.79 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|