C25H22ClNO7S — CID 159186169
5-[2-chloro-5-[1-[2-(3-hydroxypropoxy)phenyl]ethoxy]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid (PubChem CID 159186169) has the molecular formula C25H22ClNO7S and a molecular weight of 515.97 g/mol. Its IUPAC name is 5-[2-chloro-5-[1-[2-(3-hydroxypropoxy)phenyl]ethoxy]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid.
| Compound Name | 5-[2-chloro-5-[1-[2-(3-hydroxypropoxy)phenyl]ethoxy]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 159186169 |
| Molecular Formula | C25H22ClNO7S |
| Molecular Weight | 515.97 g/mol |
| Exact Mass | 515.08 |
| IUPAC Name | 5-[2-chloro-5-[1-[2-(3-hydroxypropoxy)phenyl]ethoxy]phenyl]-4,6-dioxo-7H-thieno[3,4-c]pyridine-3-carboxylic acid |
| SMILES | CC(Oc1ccc(Cl)c(N2C(=O)Cc3csc(C(=O)O)c3C2=O)c1)c1ccccc1OCCCO |
| InChI | InChI=1S/C25H22ClNO7S/c1-14(17-5-2-3-6-20(17)33-10-4-9-28)34-16-7-8-18(26)19(12-16)27-21(29)11-15-13-35-23(25(31)32)22(15)24(27)30/h2-3,5-8,12-14,28H,4,9-11H2,1H3,(H,31,32) |
| InChIKey | KNNAQSSICMEZNJ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.97 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|