C30H36BIN6O2 — CID 159186486
1-(3-iodo-2-pyridinyl)piperazine;phenylboronic acid;1-(3-phenyl-2-pyridinyl)piperazine (PubChem CID 159186486) has the molecular formula C30H36BIN6O2 and a molecular weight of 650.37 g/mol. Its IUPAC name is 1-(3-iodo-2-pyridinyl)piperazine;phenylboronic acid;1-(3-phenyl-2-pyridinyl)piperazine.
| Compound Name | 1-(3-iodo-2-pyridinyl)piperazine;phenylboronic acid;1-(3-phenyl-2-pyridinyl)piperazine |
|---|---|
| PubChem CID | 159186486 |
| Molecular Formula | C30H36BIN6O2 |
| Molecular Weight | 650.37 g/mol |
| Exact Mass | 650.20 |
| IUPAC Name | 1-(3-iodo-2-pyridinyl)piperazine;phenylboronic acid;1-(3-phenyl-2-pyridinyl)piperazine |
| SMILES | Ic1cccnc1N1CCNCC1.OB(O)c1ccccc1.c1ccc(-c2cccnc2N2CCNCC2)cc1 |
| InChI | InChI=1S/C15H17N3.C9H12IN3.C6H7BO2/c1-2-5-13(6-3-1)14-7-4-8-17-15(14)18-11-9-16-10-12-18;10-8-2-1-3-12-9(8)13-6-4-11-5-7-13;8-7(9)6-4-2-1-3-5-6/h1-8,16H,9-12H2;1-3,11H,4-7H2;1-5,8-9H |
| InChIKey | KNOAFYSFPWGVCN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 96.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|