About 2-[(1S,2R)-2-methylcyclohexyl]oxy-5-propylpyrimidine
2-[(1S,2R)-2-methylcyclohexyl]oxy-5-propylpyrimidine (PubChem CID 159188042) has the molecular formula C14H22N2O
and a molecular weight of 234.34 g/mol. Its IUPAC name is 2-[(1S,2R)-2-methylcyclohexyl]oxy-5-propylpyrimidine.
Molecular Properties
| Compound Name | 2-[(1S,2R)-2-methylcyclohexyl]oxy-5-propylpyrimidine |
| PubChem CID | 159188042 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 2-[(1S,2R)-2-methylcyclohexyl]oxy-5-propylpyrimidine |
| SMILES | CCCc1cnc(O[C@H]2CCCC[C@H]2C)nc1 |
| InChI | InChI=1S/C14H22N2O/c1-3-6-12-9-15-14(16-10-12)17-13-8-5-4-7-11(13)2/h9-11,13H,3-8H2,1-2H3/t11-,13+/m1/s1 |
| InChIKey | KNSURIFHGYRTMZ-YPMHNXCESA-N |
| XLogP | 3.39 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(1S,2R)-2-methylcyclohexyl]oxy-5-propylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S,2R)-2-methylcyclohexyl]oxy-5-propylpyrimidine?
The IUPAC name of 2-[(1S,2R)-2-methylcyclohexyl]oxy-5-propylpyrimidine (CID 159188042) is 2-[(1S,2R)-2-methylcyclohexyl]oxy-5-propylpyrimidine.
What is the SMILES notation for 2-[(1S,2R)-2-methylcyclohexyl]oxy-5-propylpyrimidine?
The canonical SMILES for 2-[(1S,2R)-2-methylcyclohexyl]oxy-5-propylpyrimidine is CCCc1cnc(O[C@H]2CCCC[C@H]2C)nc1.
What is the InChIKey of 2-[(1S,2R)-2-methylcyclohexyl]oxy-5-propylpyrimidine?
The InChIKey is KNSURIFHGYRTMZ-YPMHNXCESA-N. The full InChI is InChI=1S/C14H22N2O/c1-3-6-12-9-15-14(16-10-12)17-13-8-5-4-7-11(13)2/h9-11,13H,3-8H2,1-2H3/t11-,13+/m1/s1.
What are the key properties of 2-[(1S,2R)-2-methylcyclohexyl]oxy-5-propylpyrimidine?
2-[(1S,2R)-2-methylcyclohexyl]oxy-5-propylpyrimidine has a molecular weight of 234.34 g/mol, XLogP of 3.39, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S,2R)-2-methylcyclohexyl]oxy-5-propylpyrimidine is sourced from PubChem (CID 159188042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).