About CID 159188493
CID 159188493 (PubChem CID 159188493) has the molecular formula C26H34O4
and a molecular weight of 410.55 g/mol.
Molecular Properties
| Compound Name | CID 159188493 |
| PubChem CID | 159188493 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | — |
| SMILES | CC(=O)CCc1ccc(C2CCC[C@]3(C2)OOC2(O3)C3CC4CC(C3)CC2C4)cc1 |
| InChI | InChI=1S/C26H34O4/c1-17(27)4-5-18-6-8-21(9-7-18)22-3-2-10-25(16-22)28-26(30-29-25)23-12-19-11-20(14-23)15-24(26)13-19/h6-9,19-20,22-24H,2-5,10-16H2,1H3/t19?,20?,22?,23?,24?,25-,26?/m1/s1 |
| InChIKey | LKYHXJKSRMBRCC-IWOAHKQHSA-N |
| XLogP | 5.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 159188493 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159188493?
The IUPAC name of CID 159188493 (CID 159188493) is not available.
What is the SMILES notation for CID 159188493?
The canonical SMILES for CID 159188493 is CC(=O)CCc1ccc(C2CCC[C@]3(C2)OOC2(O3)C3CC4CC(C3)CC2C4)cc1.
What is the InChIKey of CID 159188493?
The InChIKey is LKYHXJKSRMBRCC-IWOAHKQHSA-N. The full InChI is InChI=1S/C26H34O4/c1-17(27)4-5-18-6-8-21(9-7-18)22-3-2-10-25(16-22)28-26(30-29-25)23-12-19-11-20(14-23)15-24(26)13-19/h6-9,19-20,22-24H,2-5,10-16H2,1H3/t19?,20?,22?,23?,24?,25-,26?/m1/s1.
What are the key properties of CID 159188493?
CID 159188493 has a molecular weight of 410.55 g/mol, XLogP of 5.69, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159188493 is sourced from PubChem (CID 159188493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).