C20H23F3O7S — CID 159190492
3,3,3-trifluoro-2-[4-(2,3,5-trimethylbenzoyl)oxycyclohex-2-ene-1-carbonyl]oxypropane-1-sulfonic acid (PubChem CID 159190492) has the molecular formula C20H23F3O7S and a molecular weight of 464.46 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-[4-(2,3,5-trimethylbenzoyl)oxycyclohex-2-ene-1-carbonyl]oxypropane-1-sulfonic acid.
| Compound Name | 3,3,3-trifluoro-2-[4-(2,3,5-trimethylbenzoyl)oxycyclohex-2-ene-1-carbonyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 159190492 |
| Molecular Formula | C20H23F3O7S |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | 3,3,3-trifluoro-2-[4-(2,3,5-trimethylbenzoyl)oxycyclohex-2-ene-1-carbonyl]oxypropane-1-sulfonic acid |
| SMILES | Cc1cc(C)c(C)c(C(=O)OC2C=CC(C(=O)OC(CS(=O)(=O)O)C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C20H23F3O7S/c1-11-8-12(2)13(3)16(9-11)19(25)29-15-6-4-14(5-7-15)18(24)30-17(20(21,22)23)10-31(26,27)28/h4,6,8-9,14-15,17H,5,7,10H2,1-3H3,(H,26,27,28) |
| InChIKey | JGSHECLIJHOBAT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|