C28H29NO — CID 159193903
5-[(1S,2R,6S,16R)-6-methyl-14-methylidene-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-trien-5-yl]-1H-isoindole (PubChem CID 159193903) has the molecular formula C28H29NO and a molecular weight of 395.55 g/mol. Its IUPAC name is 5-[(1S,2R,6S,16R)-6-methyl-14-methylidene-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-trien-5-yl]-1H-isoindole.
| Compound Name | 5-[(1S,2R,6S,16R)-6-methyl-14-methylidene-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-trien-5-yl]-1H-isoindole |
|---|---|
| PubChem CID | 159193903 |
| Molecular Formula | C28H29NO |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 5-[(1S,2R,6S,16R)-6-methyl-14-methylidene-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-trien-5-yl]-1H-isoindole |
| SMILES | C=C1CCC2=CC3=CC[C@]4(C)C(c5ccc6c(c5)C=NC6)=CC[C@H]4[C@@]34CC[C@]2(C1)O4 |
| InChI | InChI=1S/C28H29NO/c1-18-3-6-22-14-23-9-10-26(2)24(19-4-5-20-16-29-17-21(20)13-19)7-8-25(26)28(23)12-11-27(22,15-18)30-28/h4-5,7,9,13-14,17,25H,1,3,6,8,10-12,15-16H2,2H3/t25-,26-,27-,28-/m1/s1 |
| InChIKey | VUNBNKWCPYSQNN-BIYDSLDMSA-N |
| XLogP | 6.33 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|