About 2-pyrimidin-2-yloxy-1-azatricyclo[3.3.1.13,7]decane;hydrochloride
2-pyrimidin-2-yloxy-1-azatricyclo[3.3.1.13,7]decane;hydrochloride (PubChem CID 159194137) has the molecular formula C13H18ClN3O
and a molecular weight of 267.76 g/mol. Its IUPAC name is 2-pyrimidin-2-yloxy-1-azatricyclo[3.3.1.13,7]decane;hydrochloride.
Molecular Properties
| Compound Name | 2-pyrimidin-2-yloxy-1-azatricyclo[3.3.1.13,7]decane;hydrochloride |
| PubChem CID | 159194137 |
| Molecular Formula | C13H18ClN3O |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-pyrimidin-2-yloxy-1-azatricyclo[3.3.1.13,7]decane;hydrochloride |
| SMILES | Cl.c1cnc(OC2C3CC4CC(C3)CN2C4)nc1 |
| InChI | InChI=1S/C13H17N3O.ClH/c1-2-14-13(15-3-1)17-12-11-5-9-4-10(6-11)8-16(12)7-9;/h1-3,9-12H,4-8H2;1H |
| InChIKey | DMMGMEHVRPULJI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-pyrimidin-2-yloxy-1-azatricyclo[3.3.1.13,7]decane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrimidin-2-yloxy-1-azatricyclo[3.3.1.13,7]decane;hydrochloride?
The IUPAC name of 2-pyrimidin-2-yloxy-1-azatricyclo[3.3.1.13,7]decane;hydrochloride (CID 159194137) is 2-pyrimidin-2-yloxy-1-azatricyclo[3.3.1.13,7]decane;hydrochloride.
What is the SMILES notation for 2-pyrimidin-2-yloxy-1-azatricyclo[3.3.1.13,7]decane;hydrochloride?
The canonical SMILES for 2-pyrimidin-2-yloxy-1-azatricyclo[3.3.1.13,7]decane;hydrochloride is Cl.c1cnc(OC2C3CC4CC(C3)CN2C4)nc1.
What is the InChIKey of 2-pyrimidin-2-yloxy-1-azatricyclo[3.3.1.13,7]decane;hydrochloride?
The InChIKey is DMMGMEHVRPULJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O.ClH/c1-2-14-13(15-3-1)17-12-11-5-9-4-10(6-11)8-16(12)7-9;/h1-3,9-12H,4-8H2;1H.
What are the key properties of 2-pyrimidin-2-yloxy-1-azatricyclo[3.3.1.13,7]decane;hydrochloride?
2-pyrimidin-2-yloxy-1-azatricyclo[3.3.1.13,7]decane;hydrochloride has a molecular weight of 267.76 g/mol, XLogP of 1.97, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrimidin-2-yloxy-1-azatricyclo[3.3.1.13,7]decane;hydrochloride is sourced from PubChem (CID 159194137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).