C23H25F3N4O4 — CID 159194472
(3R,4S)-3-[(2-amino-4-pyridinyl)methyl]-4-(methoxyiminomethyl)-1-[(3S)-3-phenylbutanoyl]azetidin-2-one;2,2,2-trifluoroacetaldehyde (PubChem CID 159194472) has the molecular formula C23H25F3N4O4 and a molecular weight of 478.47 g/mol. Its IUPAC name is (3R,4S)-3-[(2-amino-4-pyridinyl)methyl]-4-(methoxyiminomethyl)-1-[(3S)-3-phenylbutanoyl]azetidin-2-one;2,2,2-trifluoroacetaldehyde.
| Compound Name | (3R,4S)-3-[(2-amino-4-pyridinyl)methyl]-4-(methoxyiminomethyl)-1-[(3S)-3-phenylbutanoyl]azetidin-2-one;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 159194472 |
| Molecular Formula | C23H25F3N4O4 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | (3R,4S)-3-[(2-amino-4-pyridinyl)methyl]-4-(methoxyiminomethyl)-1-[(3S)-3-phenylbutanoyl]azetidin-2-one;2,2,2-trifluoroacetaldehyde |
| SMILES | CON=C[C@@H]1[C@@H](Cc2ccnc(N)c2)C(=O)N1C(=O)C[C@H](C)c1ccccc1.O=CC(F)(F)F |
| InChI | InChI=1S/C21H24N4O3.C2HF3O/c1-14(16-6-4-3-5-7-16)10-20(26)25-18(13-24-28-2)17(21(25)27)11-15-8-9-23-19(22)12-15;3-2(4,5)1-6/h3-9,12-14,17-18H,10-11H2,1-2H3,(H2,22,23);1H/t14-,17+,18+;/m0./s1 |
| InChIKey | KOMKJIPIKPHVIU-QHADQLFXSA-N |
| XLogP | 3.13 |
| TPSA | 114.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|