About 5-[(3-sulfophenyl)methyldiazenyl]benzene-1,3-disulfonic acid
5-[(3-sulfophenyl)methyldiazenyl]benzene-1,3-disulfonic acid (PubChem CID 159194717) has the molecular formula C13H12N2O9S3
and a molecular weight of 436.45 g/mol. Its IUPAC name is 5-[(3-sulfophenyl)methyldiazenyl]benzene-1,3-disulfonic acid.
Molecular Properties
| Compound Name | 5-[(3-sulfophenyl)methyldiazenyl]benzene-1,3-disulfonic acid |
| PubChem CID | 159194717 |
| Molecular Formula | C13H12N2O9S3 |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 435.97 |
| IUPAC Name | 5-[(3-sulfophenyl)methyldiazenyl]benzene-1,3-disulfonic acid |
| SMILES | O=S(=O)(O)c1cccc(C/N=N/c2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c2)c1 |
| InChI | InChI=1S/C13H12N2O9S3/c16-25(17,18)11-3-1-2-9(4-11)8-14-15-10-5-12(26(19,20)21)7-13(6-10)27(22,23)24/h1-7H,8H2,(H,16,17,18)(H,19,20,21)(H,22,23,24)/b15-14+ |
| InChIKey | LRSQIYAZMMWOKX-CCEZHUSRSA-N |
| XLogP | 1.71 |
| TPSA | 187.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 5-[(3-sulfophenyl)methyldiazenyl]benzene-1,3-disulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3-sulfophenyl)methyldiazenyl]benzene-1,3-disulfonic acid?
The IUPAC name of 5-[(3-sulfophenyl)methyldiazenyl]benzene-1,3-disulfonic acid (CID 159194717) is 5-[(3-sulfophenyl)methyldiazenyl]benzene-1,3-disulfonic acid.
What is the SMILES notation for 5-[(3-sulfophenyl)methyldiazenyl]benzene-1,3-disulfonic acid?
The canonical SMILES for 5-[(3-sulfophenyl)methyldiazenyl]benzene-1,3-disulfonic acid is O=S(=O)(O)c1cccc(C/N=N/c2cc(S(=O)(=O)O)cc(S(=O)(=O)O)c2)c1.
What is the InChIKey of 5-[(3-sulfophenyl)methyldiazenyl]benzene-1,3-disulfonic acid?
The InChIKey is LRSQIYAZMMWOKX-CCEZHUSRSA-N. The full InChI is InChI=1S/C13H12N2O9S3/c16-25(17,18)11-3-1-2-9(4-11)8-14-15-10-5-12(26(19,20)21)7-13(6-10)27(22,23)24/h1-7H,8H2,(H,16,17,18)(H,19,20,21)(H,22,23,24)/b15-14+.
What are the key properties of 5-[(3-sulfophenyl)methyldiazenyl]benzene-1,3-disulfonic acid?
5-[(3-sulfophenyl)methyldiazenyl]benzene-1,3-disulfonic acid has a molecular weight of 436.45 g/mol, XLogP of 1.71, 6 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3-sulfophenyl)methyldiazenyl]benzene-1,3-disulfonic acid is sourced from PubChem (CID 159194717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).