C17H16O5 — CID 159195032
1-O-benzyl 4-O-(4-methylidene-2-oxocyclopentyl) (E)-but-2-enedioate (PubChem CID 159195032) has the molecular formula C17H16O5 and a molecular weight of 300.31 g/mol. Its IUPAC name is 1-O-benzyl 4-O-(4-methylidene-2-oxocyclopentyl) (E)-but-2-enedioate.
| Compound Name | 1-O-benzyl 4-O-(4-methylidene-2-oxocyclopentyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 159195032 |
| Molecular Formula | C17H16O5 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 1-O-benzyl 4-O-(4-methylidene-2-oxocyclopentyl) (E)-but-2-enedioate |
| SMILES | C=C1CC(=O)C(OC(=O)/C=C/C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C17H16O5/c1-12-9-14(18)15(10-12)22-17(20)8-7-16(19)21-11-13-5-3-2-4-6-13/h2-8,15H,1,9-11H2/b8-7+ |
| InChIKey | FCORQSZXUUMKLK-BQYQJAHWSA-N |
| XLogP | 2.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|