C32H30BBrF2N4O10 — CID 159195233
3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine;methyl 4-bromo-3-nitrobenzoate;methyl 4-(3-fluoro-4-pyridinyl)-3-nitrobenzoate (PubChem CID 159195233) has the molecular formula C32H30BBrF2N4O10 and a molecular weight of 759.32 g/mol. Its IUPAC name is 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine;methyl 4-bromo-3-nitrobenzoate;methyl 4-(3-fluoro-4-pyridinyl)-3-nitrobenzoate.
| Compound Name | 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine;methyl 4-bromo-3-nitrobenzoate;methyl 4-(3-fluoro-4-pyridinyl)-3-nitrobenzoate |
|---|---|
| PubChem CID | 159195233 |
| Molecular Formula | C32H30BBrF2N4O10 |
| Molecular Weight | 759.32 g/mol |
| Exact Mass | 758.12 |
| IUPAC Name | 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine;methyl 4-bromo-3-nitrobenzoate;methyl 4-(3-fluoro-4-pyridinyl)-3-nitrobenzoate |
| SMILES | CC1(C)OB(c2ccncc2F)OC1(C)C.COC(=O)c1ccc(-c2ccncc2F)c([N+](=O)[O-])c1.COC(=O)c1ccc(Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H9FN2O4.C11H15BFNO2.C8H6BrNO4/c1-20-13(17)8-2-3-10(12(6-8)16(18)19)9-4-5-15-7-11(9)14;1-10(2)11(3,4)16-12(15-10)8-5-6-14-7-9(8)13;1-14-8(11)5-2-3-6(9)7(4-5)10(12)13/h2-7H,1H3;5-7H,1-4H3;2-4H,1H3 |
| InChIKey | KOOQDGANUKSQAX-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 183.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.32 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|