About 2-[N-ethyl-4-[(6-methoxy-2,3-dihydro-1,3-benzothiazol-2-yl)diazenyl]anilino]ethanol
2-[N-ethyl-4-[(6-methoxy-2,3-dihydro-1,3-benzothiazol-2-yl)diazenyl]anilino]ethanol (PubChem CID 15919528) has the molecular formula C18H22N4O2S
and a molecular weight of 358.47 g/mol. Its IUPAC name is 2-[N-ethyl-4-[(6-methoxy-2,3-dihydro-1,3-benzothiazol-2-yl)diazenyl]anilino]ethanol.
Molecular Properties
| Compound Name | 2-[N-ethyl-4-[(6-methoxy-2,3-dihydro-1,3-benzothiazol-2-yl)diazenyl]anilino]ethanol |
| PubChem CID | 15919528 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 2-[N-ethyl-4-[(6-methoxy-2,3-dihydro-1,3-benzothiazol-2-yl)diazenyl]anilino]ethanol |
| SMILES | CCN(CCO)c1ccc(/N=N/C2Nc3ccc(OC)cc3S2)cc1 |
| InChI | InChI=1S/C18H22N4O2S/c1-3-22(10-11-23)14-6-4-13(5-7-14)20-21-18-19-16-9-8-15(24-2)12-17(16)25-18/h4-9,12,18-19,23H,3,10-11H2,1-2H3/b21-20+ |
| InChIKey | GONYWVCPBDQTGQ-QZQOTICOSA-N |
| XLogP | 4.10 |
| TPSA | 69.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[N-ethyl-4-[(6-methoxy-2,3-dihydro-1,3-benzothiazol-2-yl)diazenyl]anilino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[N-ethyl-4-[(6-methoxy-2,3-dihydro-1,3-benzothiazol-2-yl)diazenyl]anilino]ethanol?
The IUPAC name of 2-[N-ethyl-4-[(6-methoxy-2,3-dihydro-1,3-benzothiazol-2-yl)diazenyl]anilino]ethanol (CID 15919528) is 2-[N-ethyl-4-[(6-methoxy-2,3-dihydro-1,3-benzothiazol-2-yl)diazenyl]anilino]ethanol.
What is the SMILES notation for 2-[N-ethyl-4-[(6-methoxy-2,3-dihydro-1,3-benzothiazol-2-yl)diazenyl]anilino]ethanol?
The canonical SMILES for 2-[N-ethyl-4-[(6-methoxy-2,3-dihydro-1,3-benzothiazol-2-yl)diazenyl]anilino]ethanol is CCN(CCO)c1ccc(/N=N/C2Nc3ccc(OC)cc3S2)cc1.
What is the InChIKey of 2-[N-ethyl-4-[(6-methoxy-2,3-dihydro-1,3-benzothiazol-2-yl)diazenyl]anilino]ethanol?
The InChIKey is GONYWVCPBDQTGQ-QZQOTICOSA-N. The full InChI is InChI=1S/C18H22N4O2S/c1-3-22(10-11-23)14-6-4-13(5-7-14)20-21-18-19-16-9-8-15(24-2)12-17(16)25-18/h4-9,12,18-19,23H,3,10-11H2,1-2H3/b21-20+.
What are the key properties of 2-[N-ethyl-4-[(6-methoxy-2,3-dihydro-1,3-benzothiazol-2-yl)diazenyl]anilino]ethanol?
2-[N-ethyl-4-[(6-methoxy-2,3-dihydro-1,3-benzothiazol-2-yl)diazenyl]anilino]ethanol has a molecular weight of 358.47 g/mol, XLogP of 4.10, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[N-ethyl-4-[(6-methoxy-2,3-dihydro-1,3-benzothiazol-2-yl)diazenyl]anilino]ethanol is sourced from PubChem (CID 15919528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).