C21H21ClN4O2 — CID 159195562
(1R)-8-(2-chlorophenyl)-9-(cyclobutylamino)-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one (PubChem CID 159195562) has the molecular formula C21H21ClN4O2 and a molecular weight of 396.88 g/mol. Its IUPAC name is (1R)-8-(2-chlorophenyl)-9-(cyclobutylamino)-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one.
| Compound Name | (1R)-8-(2-chlorophenyl)-9-(cyclobutylamino)-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
|---|---|
| PubChem CID | 159195562 |
| Molecular Formula | C21H21ClN4O2 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | (1R)-8-(2-chlorophenyl)-9-(cyclobutylamino)-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
| SMILES | C[C@@H]1C(=O)NN=C2COc3cc(-c4ccccc4Cl)c(NC4CCC4)cc3N21 |
| InChI | InChI=1S/C21H21ClN4O2/c1-12-21(27)25-24-20-11-28-19-9-15(14-7-2-3-8-16(14)22)17(10-18(19)26(12)20)23-13-5-4-6-13/h2-3,7-10,12-13,23H,4-6,11H2,1H3,(H,25,27)/t12-/m1/s1 |
| InChIKey | KOPQSVPSCQFQBV-GFCCVEGCSA-N |
| XLogP | 4.00 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|