About pyrrolidin-3-yl hydrogen phosphate;triethylazanium
pyrrolidin-3-yl hydrogen phosphate;triethylazanium (PubChem CID 159195810) has the molecular formula C10H25N2O4P
and a molecular weight of 268.29 g/mol. Its IUPAC name is pyrrolidin-3-yl hydrogen phosphate;triethylazanium.
Molecular Properties
| Compound Name | pyrrolidin-3-yl hydrogen phosphate;triethylazanium |
| PubChem CID | 159195810 |
| Molecular Formula | C10H25N2O4P |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | pyrrolidin-3-yl hydrogen phosphate;triethylazanium |
| SMILES | CC[NH+](CC)CC.O=P([O-])(O)OC1CCNC1 |
| InChI | InChI=1S/C6H15N.C4H10NO4P/c1-4-7(5-2)6-3;6-10(7,8)9-4-1-2-5-3-4/h4-6H2,1-3H3;4-5H,1-3H2,(H2,6,7,8) |
| InChIKey | KOQMGIRUYMUKBL-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze pyrrolidin-3-yl hydrogen phosphate;triethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidin-3-yl hydrogen phosphate;triethylazanium?
The IUPAC name of pyrrolidin-3-yl hydrogen phosphate;triethylazanium (CID 159195810) is pyrrolidin-3-yl hydrogen phosphate;triethylazanium.
What is the SMILES notation for pyrrolidin-3-yl hydrogen phosphate;triethylazanium?
The canonical SMILES for pyrrolidin-3-yl hydrogen phosphate;triethylazanium is CC[NH+](CC)CC.O=P([O-])(O)OC1CCNC1.
What is the InChIKey of pyrrolidin-3-yl hydrogen phosphate;triethylazanium?
The InChIKey is KOQMGIRUYMUKBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C4H10NO4P/c1-4-7(5-2)6-3;6-10(7,8)9-4-1-2-5-3-4/h4-6H2,1-3H3;4-5H,1-3H2,(H2,6,7,8).
What are the key properties of pyrrolidin-3-yl hydrogen phosphate;triethylazanium?
pyrrolidin-3-yl hydrogen phosphate;triethylazanium has a molecular weight of 268.29 g/mol, XLogP of -1.24, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidin-3-yl hydrogen phosphate;triethylazanium is sourced from PubChem (CID 159195810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).