C25H24Cl2N2O4 — CID 159195894
(3,5-dichloro-4-hydroxyphenyl)-(6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)methanone;6-methyl-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 159195894) has the molecular formula C25H24Cl2N2O4 and a molecular weight of 487.38 g/mol. Its IUPAC name is (3,5-dichloro-4-hydroxyphenyl)-(6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)methanone;6-methyl-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | (3,5-dichloro-4-hydroxyphenyl)-(6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)methanone;6-methyl-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 159195894 |
| Molecular Formula | C25H24Cl2N2O4 |
| Molecular Weight | 487.38 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | (3,5-dichloro-4-hydroxyphenyl)-(6-methyl-2,3-dihydro-1,4-benzoxazin-4-yl)methanone;6-methyl-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | Cc1ccc2c(c1)N(C(=O)c1cc(Cl)c(O)c(Cl)c1)CCO2.Cc1ccc2c(c1)NCCO2 |
| InChI | InChI=1S/C16H13Cl2NO3.C9H11NO/c1-9-2-3-14-13(6-9)19(4-5-22-14)16(21)10-7-11(17)15(20)12(18)8-10;1-7-2-3-9-8(6-7)10-4-5-11-9/h2-3,6-8,20H,4-5H2,1H3;2-3,6,10H,4-5H2,1H3 |
| InChIKey | KOQSSXVNZATLHQ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.38 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |