C20H40 — CID 159196394
1-tert-butyl-1-propan-2-ylcyclopropane;2,2,4,4-tetramethyl-3-methylidenepentane (PubChem CID 159196394) has the molecular formula C20H40 and a molecular weight of 280.54 g/mol. Its IUPAC name is 1-tert-butyl-1-propan-2-ylcyclopropane;2,2,4,4-tetramethyl-3-methylidenepentane.
| Compound Name | 1-tert-butyl-1-propan-2-ylcyclopropane;2,2,4,4-tetramethyl-3-methylidenepentane |
|---|---|
| PubChem CID | 159196394 |
| Molecular Formula | C20H40 |
| Molecular Weight | 280.54 g/mol |
| Exact Mass | 280.31 |
| IUPAC Name | 1-tert-butyl-1-propan-2-ylcyclopropane;2,2,4,4-tetramethyl-3-methylidenepentane |
| SMILES | C=C(C(C)(C)C)C(C)(C)C.CC(C)C1(C(C)(C)C)CC1 |
| InChI | InChI=1S/2C10H20/c1-8(2)10(6-7-10)9(3,4)5;1-8(9(2,3)4)10(5,6)7/h8H,6-7H2,1-5H3;1H2,2-7H3 |
| InChIKey | KOSGWFKZXJPCNV-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.54 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|