About bis(ethenyl)-dimethylsilane;dichloro(difluoro)methane;ethenylsilane
bis(ethenyl)-dimethylsilane;dichloro(difluoro)methane;ethenylsilane (PubChem CID 159196960) has the molecular formula C9H18Cl2F2Si2
and a molecular weight of 291.32 g/mol. Its IUPAC name is bis(ethenyl)-dimethylsilane;dichloro(difluoro)methane;ethenylsilane.
Molecular Properties
| Compound Name | bis(ethenyl)-dimethylsilane;dichloro(difluoro)methane;ethenylsilane |
| PubChem CID | 159196960 |
| Molecular Formula | C9H18Cl2F2Si2 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | bis(ethenyl)-dimethylsilane;dichloro(difluoro)methane;ethenylsilane |
| SMILES | C=C[SiH3].C=C[Si](C)(C)C=C.FC(F)(Cl)Cl |
| InChI | InChI=1S/C6H12Si.C2H6Si.CCl2F2/c1-5-7(3,4)6-2;1-2-3;2-1(3,4)5/h5-6H,1-2H2,3-4H3;2H,1H2,3H3; |
| InChIKey | KOTZCWXCJGMXJZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(ethenyl)-dimethylsilane;dichloro(difluoro)methane;ethenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(ethenyl)-dimethylsilane;dichloro(difluoro)methane;ethenylsilane?
The IUPAC name of bis(ethenyl)-dimethylsilane;dichloro(difluoro)methane;ethenylsilane (CID 159196960) is bis(ethenyl)-dimethylsilane;dichloro(difluoro)methane;ethenylsilane.
What is the SMILES notation for bis(ethenyl)-dimethylsilane;dichloro(difluoro)methane;ethenylsilane?
The canonical SMILES for bis(ethenyl)-dimethylsilane;dichloro(difluoro)methane;ethenylsilane is C=C[SiH3].C=C[Si](C)(C)C=C.FC(F)(Cl)Cl.
What is the InChIKey of bis(ethenyl)-dimethylsilane;dichloro(difluoro)methane;ethenylsilane?
The InChIKey is KOTZCWXCJGMXJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12Si.C2H6Si.CCl2F2/c1-5-7(3,4)6-2;1-2-3;2-1(3,4)5/h5-6H,1-2H2,3-4H3;2H,1H2,3H3;.
What are the key properties of bis(ethenyl)-dimethylsilane;dichloro(difluoro)methane;ethenylsilane?
bis(ethenyl)-dimethylsilane;dichloro(difluoro)methane;ethenylsilane has a molecular weight of 291.32 g/mol, XLogP of 3.65, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(ethenyl)-dimethylsilane;dichloro(difluoro)methane;ethenylsilane is sourced from PubChem (CID 159196960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).