C22H41NO — CID 159198145
ethane;1,3,4,5,6-penta(propan-2-yl)pyridin-2-one (PubChem CID 159198145) has the molecular formula C22H41NO and a molecular weight of 335.58 g/mol. Its IUPAC name is ethane;1,3,4,5,6-penta(propan-2-yl)pyridin-2-one.
| Compound Name | ethane;1,3,4,5,6-penta(propan-2-yl)pyridin-2-one |
|---|---|
| PubChem CID | 159198145 |
| Molecular Formula | C22H41NO |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.32 |
| IUPAC Name | ethane;1,3,4,5,6-penta(propan-2-yl)pyridin-2-one |
| SMILES | CC.CC(C)c1c(C(C)C)c(C(C)C)n(C(C)C)c(=O)c1C(C)C |
| InChI | InChI=1S/C20H35NO.C2H6/c1-11(2)16-17(12(3)4)19(14(7)8)21(15(9)10)20(22)18(16)13(5)6;1-2/h11-15H,1-10H3;1-2H3 |
| InChIKey | KOXWVKSHPCXISG-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |