C20H35NO — CID 159198146
1,3,4,5,6-penta(propan-2-yl)pyridin-2-one (PubChem CID 159198146) has the molecular formula C20H35NO and a molecular weight of 305.51 g/mol. Its IUPAC name is 1,3,4,5,6-penta(propan-2-yl)pyridin-2-one.
| Compound Name | 1,3,4,5,6-penta(propan-2-yl)pyridin-2-one |
|---|---|
| PubChem CID | 159198146 |
| Molecular Formula | C20H35NO |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.27 |
| IUPAC Name | 1,3,4,5,6-penta(propan-2-yl)pyridin-2-one |
| SMILES | CC(C)c1c(C(C)C)c(C(C)C)n(C(C)C)c(=O)c1C(C)C |
| InChI | InChI=1S/C20H35NO/c1-11(2)16-17(12(3)4)19(14(7)8)21(15(9)10)20(22)18(16)13(5)6/h11-15H,1-10H3 |
| InChIKey | MUFNUUYKYMQZHK-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |