About 3,6-diiodo-2H-indazole;3-iodo-1,6-dimethylindazole;methane
3,6-diiodo-2H-indazole;3-iodo-1,6-dimethylindazole;methane (PubChem CID 159198421) has the molecular formula C18H21I3N4
and a molecular weight of 674.11 g/mol. Its IUPAC name is 3,6-diiodo-2H-indazole;3-iodo-1,6-dimethylindazole;methane.
Molecular Properties
| Compound Name | 3,6-diiodo-2H-indazole;3-iodo-1,6-dimethylindazole;methane |
| PubChem CID | 159198421 |
| Molecular Formula | C18H21I3N4 |
| Molecular Weight | 674.11 g/mol |
| Exact Mass | 673.89 |
| IUPAC Name | 3,6-diiodo-2H-indazole;3-iodo-1,6-dimethylindazole;methane |
| SMILES | C.C.Cc1ccc2c(I)nn(C)c2c1.Ic1ccc2c(I)[nH]nc2c1 |
| InChI | InChI=1S/C9H9IN2.C7H4I2N2.2CH4/c1-6-3-4-7-8(5-6)12(2)11-9(7)10;8-4-1-2-5-6(3-4)10-11-7(5)9;;/h3-5H,1-2H3;1-3H,(H,10,11);2*1H4 |
| InChIKey | KOYSNKAMKPXSHI-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 674.11 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3,6-diiodo-2H-indazole;3-iodo-1,6-dimethylindazole;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-diiodo-2H-indazole;3-iodo-1,6-dimethylindazole;methane?
The IUPAC name of 3,6-diiodo-2H-indazole;3-iodo-1,6-dimethylindazole;methane (CID 159198421) is 3,6-diiodo-2H-indazole;3-iodo-1,6-dimethylindazole;methane.
What is the SMILES notation for 3,6-diiodo-2H-indazole;3-iodo-1,6-dimethylindazole;methane?
The canonical SMILES for 3,6-diiodo-2H-indazole;3-iodo-1,6-dimethylindazole;methane is C.C.Cc1ccc2c(I)nn(C)c2c1.Ic1ccc2c(I)[nH]nc2c1.
What is the InChIKey of 3,6-diiodo-2H-indazole;3-iodo-1,6-dimethylindazole;methane?
The InChIKey is KOYSNKAMKPXSHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9IN2.C7H4I2N2.2CH4/c1-6-3-4-7-8(5-6)12(2)11-9(7)10;8-4-1-2-5-6(3-4)10-11-7(5)9;;/h3-5H,1-2H3;1-3H,(H,10,11);2*1H4.
What are the key properties of 3,6-diiodo-2H-indazole;3-iodo-1,6-dimethylindazole;methane?
3,6-diiodo-2H-indazole;3-iodo-1,6-dimethylindazole;methane has a molecular weight of 674.11 g/mol, XLogP of 6.53, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-diiodo-2H-indazole;3-iodo-1,6-dimethylindazole;methane is sourced from PubChem (CID 159198421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).