About 6-(6-methyl-4-piperidin-1-ylquinazolin-7-yl)-5-(trifluoromethyl)pyridin-2-amine;sulfur dioxide
6-(6-methyl-4-piperidin-1-ylquinazolin-7-yl)-5-(trifluoromethyl)pyridin-2-amine;sulfur dioxide (PubChem CID 159199103) has the molecular formula C20H20F3N5O2S
and a molecular weight of 451.47 g/mol. Its IUPAC name is 6-(6-methyl-4-piperidin-1-ylquinazolin-7-yl)-5-(trifluoromethyl)pyridin-2-amine;sulfur dioxide.
Molecular Properties
| Compound Name | 6-(6-methyl-4-piperidin-1-ylquinazolin-7-yl)-5-(trifluoromethyl)pyridin-2-amine;sulfur dioxide |
| PubChem CID | 159199103 |
| Molecular Formula | C20H20F3N5O2S |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 6-(6-methyl-4-piperidin-1-ylquinazolin-7-yl)-5-(trifluoromethyl)pyridin-2-amine;sulfur dioxide |
| SMILES | Cc1cc2c(N3CCCCC3)ncnc2cc1-c1nc(N)ccc1C(F)(F)F.O=S=O |
| InChI | InChI=1S/C20H20F3N5.O2S/c1-12-9-14-16(25-11-26-19(14)28-7-3-2-4-8-28)10-13(12)18-15(20(21,22)23)5-6-17(24)27-18;1-3-2/h5-6,9-11H,2-4,7-8H2,1H3,(H2,24,27); |
| InChIKey | KPAWNFKHTVXUHY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 102.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-(6-methyl-4-piperidin-1-ylquinazolin-7-yl)-5-(trifluoromethyl)pyridin-2-amine;sulfur dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(6-methyl-4-piperidin-1-ylquinazolin-7-yl)-5-(trifluoromethyl)pyridin-2-amine;sulfur dioxide?
The IUPAC name of 6-(6-methyl-4-piperidin-1-ylquinazolin-7-yl)-5-(trifluoromethyl)pyridin-2-amine;sulfur dioxide (CID 159199103) is 6-(6-methyl-4-piperidin-1-ylquinazolin-7-yl)-5-(trifluoromethyl)pyridin-2-amine;sulfur dioxide.
What is the SMILES notation for 6-(6-methyl-4-piperidin-1-ylquinazolin-7-yl)-5-(trifluoromethyl)pyridin-2-amine;sulfur dioxide?
The canonical SMILES for 6-(6-methyl-4-piperidin-1-ylquinazolin-7-yl)-5-(trifluoromethyl)pyridin-2-amine;sulfur dioxide is Cc1cc2c(N3CCCCC3)ncnc2cc1-c1nc(N)ccc1C(F)(F)F.O=S=O.
What is the InChIKey of 6-(6-methyl-4-piperidin-1-ylquinazolin-7-yl)-5-(trifluoromethyl)pyridin-2-amine;sulfur dioxide?
The InChIKey is KPAWNFKHTVXUHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20F3N5.O2S/c1-12-9-14-16(25-11-26-19(14)28-7-3-2-4-8-28)10-13(12)18-15(20(21,22)23)5-6-17(24)27-18;1-3-2/h5-6,9-11H,2-4,7-8H2,1H3,(H2,24,27);.
What are the key properties of 6-(6-methyl-4-piperidin-1-ylquinazolin-7-yl)-5-(trifluoromethyl)pyridin-2-amine;sulfur dioxide?
6-(6-methyl-4-piperidin-1-ylquinazolin-7-yl)-5-(trifluoromethyl)pyridin-2-amine;sulfur dioxide has a molecular weight of 451.47 g/mol, XLogP of 3.92, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(6-methyl-4-piperidin-1-ylquinazolin-7-yl)-5-(trifluoromethyl)pyridin-2-amine;sulfur dioxide is sourced from PubChem (CID 159199103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).