C20H20F3N5 — CID 159199104
6-(6-methyl-4-piperidin-1-ylquinazolin-7-yl)-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 159199104) has the molecular formula C20H20F3N5 and a molecular weight of 387.41 g/mol. Its IUPAC name is 6-(6-methyl-4-piperidin-1-ylquinazolin-7-yl)-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-(6-methyl-4-piperidin-1-ylquinazolin-7-yl)-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 159199104 |
| Molecular Formula | C20H20F3N5 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 6-(6-methyl-4-piperidin-1-ylquinazolin-7-yl)-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | Cc1cc2c(N3CCCCC3)ncnc2cc1-c1nc(N)ccc1C(F)(F)F |
| InChI | InChI=1S/C20H20F3N5/c1-12-9-14-16(25-11-26-19(14)28-7-3-2-4-8-28)10-13(12)18-15(20(21,22)23)5-6-17(24)27-18/h5-6,9-11H,2-4,7-8H2,1H3,(H2,24,27) |
| InChIKey | LUZYDDRUBAITIO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |