C16H19N2O7P — CID 15920035
[4-(6,7-dihydroxy-1,2,3,4-tetrahydroisoquinolin-1-yl)-5-hydroxy-6-methyl-3-pyridinyl]methyl dihydrogen phosphate (PubChem CID 15920035) has the molecular formula C16H19N2O7P and a molecular weight of 382.31 g/mol. Its IUPAC name is [4-(6,7-dihydroxy-1,2,3,4-tetrahydroisoquinolin-1-yl)-5-hydroxy-6-methyl-3-pyridinyl]methyl dihydrogen phosphate.
| Compound Name | [4-(6,7-dihydroxy-1,2,3,4-tetrahydroisoquinolin-1-yl)-5-hydroxy-6-methyl-3-pyridinyl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 15920035 |
| Molecular Formula | C16H19N2O7P |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | [4-(6,7-dihydroxy-1,2,3,4-tetrahydroisoquinolin-1-yl)-5-hydroxy-6-methyl-3-pyridinyl]methyl dihydrogen phosphate |
| SMILES | Cc1ncc(COP(=O)(O)O)c(C2NCCc3cc(O)c(O)cc32)c1O |
| InChI | InChI=1S/C16H19N2O7P/c1-8-16(21)14(10(6-18-8)7-25-26(22,23)24)15-11-5-13(20)12(19)4-9(11)2-3-17-15/h4-6,15,17,19-21H,2-3,7H2,1H3,(H2,22,23,24) |
| InChIKey | CSZAPGPAJBWYGQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 152.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|