About 2-N-methylpropane-1,2-diamine
2-N-methylpropane-1,2-diamine (PubChem CID 15920061) has the molecular formula C4H12N2
and a molecular weight of 88.15 g/mol. Its IUPAC name is 2-N-methylpropane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-methylpropane-1,2-diamine |
| PubChem CID | 15920061 |
| Molecular Formula | C4H12N2 |
| Molecular Weight | 88.15 g/mol |
| Exact Mass | 88.10 |
| IUPAC Name | 2-N-methylpropane-1,2-diamine |
| SMILES | CNC(C)CN |
| InChI | InChI=1S/C4H12N2/c1-4(3-5)6-2/h4,6H,3,5H2,1-2H3 |
| InChIKey | GINJNNGWMNSBIG-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 88.15 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-N-methylpropane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-methylpropane-1,2-diamine?
The IUPAC name of 2-N-methylpropane-1,2-diamine (CID 15920061) is 2-N-methylpropane-1,2-diamine.
What is the SMILES notation for 2-N-methylpropane-1,2-diamine?
The canonical SMILES for 2-N-methylpropane-1,2-diamine is CNC(C)CN.
What is the InChIKey of 2-N-methylpropane-1,2-diamine?
The InChIKey is GINJNNGWMNSBIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12N2/c1-4(3-5)6-2/h4,6H,3,5H2,1-2H3.
What are the key properties of 2-N-methylpropane-1,2-diamine?
2-N-methylpropane-1,2-diamine has a molecular weight of 88.15 g/mol, XLogP of -0.45, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-methylpropane-1,2-diamine is sourced from PubChem (CID 15920061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).