About 6-(diethylamino)hexan-3-one;methanamine;quinoline
6-(diethylamino)hexan-3-one;methanamine;quinoline (PubChem CID 159201396) has the molecular formula C20H33N3O
and a molecular weight of 331.50 g/mol. Its IUPAC name is 6-(diethylamino)hexan-3-one;methanamine;quinoline.
Molecular Properties
| Compound Name | 6-(diethylamino)hexan-3-one;methanamine;quinoline |
| PubChem CID | 159201396 |
| Molecular Formula | C20H33N3O |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.26 |
| IUPAC Name | 6-(diethylamino)hexan-3-one;methanamine;quinoline |
| SMILES | CCC(=O)CCCN(CC)CC.CN.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C10H21NO.C9H7N.CH5N/c1-4-10(12)8-7-9-11(5-2)6-3;1-2-6-9-8(4-1)5-3-7-10-9;1-2/h4-9H2,1-3H3;1-7H;2H2,1H3 |
| InChIKey | KPILNNYKXXFZJR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(diethylamino)hexan-3-one;methanamine;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(diethylamino)hexan-3-one;methanamine;quinoline?
The IUPAC name of 6-(diethylamino)hexan-3-one;methanamine;quinoline (CID 159201396) is 6-(diethylamino)hexan-3-one;methanamine;quinoline.
What is the SMILES notation for 6-(diethylamino)hexan-3-one;methanamine;quinoline?
The canonical SMILES for 6-(diethylamino)hexan-3-one;methanamine;quinoline is CCC(=O)CCCN(CC)CC.CN.c1ccc2ncccc2c1.
What is the InChIKey of 6-(diethylamino)hexan-3-one;methanamine;quinoline?
The InChIKey is KPILNNYKXXFZJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO.C9H7N.CH5N/c1-4-10(12)8-7-9-11(5-2)6-3;1-2-6-9-8(4-1)5-3-7-10-9;1-2/h4-9H2,1-3H3;1-7H;2H2,1H3.
What are the key properties of 6-(diethylamino)hexan-3-one;methanamine;quinoline?
6-(diethylamino)hexan-3-one;methanamine;quinoline has a molecular weight of 331.50 g/mol, XLogP of 3.90, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(diethylamino)hexan-3-one;methanamine;quinoline is sourced from PubChem (CID 159201396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).