C19H34 — CID 15920180
1-(1-cyclohexylethyl)-2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 15920180) has the molecular formula C19H34 and a molecular weight of 262.48 g/mol. Its IUPAC name is 1-(1-cyclohexylethyl)-2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 1-(1-cyclohexylethyl)-2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 15920180 |
| Molecular Formula | C19H34 |
| Molecular Weight | 262.48 g/mol |
| Exact Mass | 262.27 |
| IUPAC Name | 1-(1-cyclohexylethyl)-2-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CC1CCC2CCCCC2C1C(C)C1CCCCC1 |
| InChI | InChI=1S/C19H34/c1-14-12-13-17-10-6-7-11-18(17)19(14)15(2)16-8-4-3-5-9-16/h14-19H,3-13H2,1-2H3 |
| InChIKey | LDYPPPSTFVVVSA-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.48 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |