C12H17NOS — CID 159202573
7-tert-butyl-1-methylidene-2,3-dihydrothieno[2,3-c]pyridine 1-oxide (PubChem CID 159202573) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 7-tert-butyl-1-methylidene-2,3-dihydrothieno[2,3-c]pyridine 1-oxide.
| Compound Name | 7-tert-butyl-1-methylidene-2,3-dihydrothieno[2,3-c]pyridine 1-oxide |
|---|---|
| PubChem CID | 159202573 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 7-tert-butyl-1-methylidene-2,3-dihydrothieno[2,3-c]pyridine 1-oxide |
| SMILES | C=S1(=O)CCc2ccnc(C(C)(C)C)c21 |
| InChI | InChI=1S/C12H17NOS/c1-12(2,3)11-10-9(5-7-13-11)6-8-15(10,4)14/h5,7H,4,6,8H2,1-3H3 |
| InChIKey | AGOQHGCITWVWNK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|