C22H38F12O7 — CID 159202939
1,1,1,7,7,7-hexafluoro-2,6-dimethylheptane-2,4,6-triol;1,1,1-trifluoro-2-methylhexane-2,5-diol;1,1,1-trifluoro-2-methylpentane-2,4-diol (PubChem CID 159202939) has the molecular formula C22H38F12O7 and a molecular weight of 642.52 g/mol. Its IUPAC name is 1,1,1,7,7,7-hexafluoro-2,6-dimethylheptane-2,4,6-triol;1,1,1-trifluoro-2-methylhexane-2,5-diol;1,1,1-trifluoro-2-methylpentane-2,4-diol.
| Compound Name | 1,1,1,7,7,7-hexafluoro-2,6-dimethylheptane-2,4,6-triol;1,1,1-trifluoro-2-methylhexane-2,5-diol;1,1,1-trifluoro-2-methylpentane-2,4-diol |
|---|---|
| PubChem CID | 159202939 |
| Molecular Formula | C22H38F12O7 |
| Molecular Weight | 642.52 g/mol |
| Exact Mass | 642.24 |
| IUPAC Name | 1,1,1,7,7,7-hexafluoro-2,6-dimethylheptane-2,4,6-triol;1,1,1-trifluoro-2-methylhexane-2,5-diol;1,1,1-trifluoro-2-methylpentane-2,4-diol |
| SMILES | CC(O)(CC(O)CC(C)(O)C(F)(F)F)C(F)(F)F.CC(O)CC(C)(O)C(F)(F)F.CC(O)CCC(C)(O)C(F)(F)F |
| InChI | InChI=1S/C9H14F6O3.C7H13F3O2.C6H11F3O2/c1-6(17,8(10,11)12)3-5(16)4-7(2,18)9(13,14)15;1-5(11)3-4-6(2,12)7(8,9)10;1-4(10)3-5(2,11)6(7,8)9/h5,16-18H,3-4H2,1-2H3;5,11-12H,3-4H2,1-2H3;4,10-11H,3H2,1-2H3 |
| InChIKey | KPNCPTQCECIYML-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |