C28H29F3N4O7 — CID 159204133
2-[2-[4-[[(3R,3aR,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-2-methoxyanilino]-5-(trifluoromethyl)pyrimidin-4-yl]oxy-6-ethyl-N-methylbenzamide (PubChem CID 159204133) has the molecular formula C28H29F3N4O7 and a molecular weight of 590.56 g/mol. Its IUPAC name is 2-[2-[4-[[(3R,3aR,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-2-methoxyanilino]-5-(trifluoromethyl)pyrimidin-4-yl]oxy-6-ethyl-N-methylbenzamide.
| Compound Name | 2-[2-[4-[[(3R,3aR,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-2-methoxyanilino]-5-(trifluoromethyl)pyrimidin-4-yl]oxy-6-ethyl-N-methylbenzamide |
|---|---|
| PubChem CID | 159204133 |
| Molecular Formula | C28H29F3N4O7 |
| Molecular Weight | 590.56 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | 2-[2-[4-[[(3R,3aR,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-2-methoxyanilino]-5-(trifluoromethyl)pyrimidin-4-yl]oxy-6-ethyl-N-methylbenzamide |
| SMILES | CCc1cccc(Oc2nc(Nc3ccc(OC4CO[C@@H]5[C@H](O)CO[C@H]45)cc3OC)ncc2C(F)(F)F)c1C(=O)NC |
| InChI | InChI=1S/C28H29F3N4O7/c1-4-14-6-5-7-19(22(14)25(37)32-2)42-26-16(28(29,30)31)11-33-27(35-26)34-17-9-8-15(10-20(17)38-3)41-21-13-40-23-18(36)12-39-24(21)23/h5-11,18,21,23-24,36H,4,12-13H2,1-3H3,(H,32,37)(H,33,34,35)/t18-,21?,23-,24-/m1/s1 |
| InChIKey | KPQSKVZTWLKSKC-IDGPZQDESA-N |
| XLogP | 3.87 |
| TPSA | 133.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |