C21H32O — CID 159204272
(1R,5R,7R,8R,9S,10R,12R,14R)-3,7,8,11,11,14-hexamethyltetracyclo[7.5.1.01,5.010,12]pentadec-2-en-15-one (PubChem CID 159204272) has the molecular formula C21H32O and a molecular weight of 300.49 g/mol. Its IUPAC name is (1R,5R,7R,8R,9S,10R,12R,14R)-3,7,8,11,11,14-hexamethyltetracyclo[7.5.1.01,5.010,12]pentadec-2-en-15-one.
| Compound Name | (1R,5R,7R,8R,9S,10R,12R,14R)-3,7,8,11,11,14-hexamethyltetracyclo[7.5.1.01,5.010,12]pentadec-2-en-15-one |
|---|---|
| PubChem CID | 159204272 |
| Molecular Formula | C21H32O |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | (1R,5R,7R,8R,9S,10R,12R,14R)-3,7,8,11,11,14-hexamethyltetracyclo[7.5.1.01,5.010,12]pentadec-2-en-15-one |
| SMILES | CC1=C[C@]23C(=O)[C@@H]([C@H](C)[C@H](C)C[C@@H]2C1)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C21H32O/c1-11-7-15-8-12(2)14(4)17-18-16(20(18,5)6)9-13(3)21(15,10-11)19(17)22/h10,12-18H,7-9H2,1-6H3/t12-,13-,14-,15+,16-,17+,18-,21-/m1/s1 |
| InChIKey | RULUWKJMNCANKV-IXGJKGSFSA-N |
| XLogP | 5.11 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|