About 4-fluorobenzaldehyde;3-(4-fluorophenyl)-2-methylprop-2-enoic acid
4-fluorobenzaldehyde;3-(4-fluorophenyl)-2-methylprop-2-enoic acid (PubChem CID 159204345) has the molecular formula C17H14F2O3
and a molecular weight of 304.29 g/mol. Its IUPAC name is 4-fluorobenzaldehyde;3-(4-fluorophenyl)-2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | 4-fluorobenzaldehyde;3-(4-fluorophenyl)-2-methylprop-2-enoic acid |
| PubChem CID | 159204345 |
| Molecular Formula | C17H14F2O3 |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 4-fluorobenzaldehyde;3-(4-fluorophenyl)-2-methylprop-2-enoic acid |
| SMILES | CC(=Cc1ccc(F)cc1)C(=O)O.O=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C10H9FO2.C7H5FO/c1-7(10(12)13)6-8-2-4-9(11)5-3-8;8-7-3-1-6(5-9)2-4-7/h2-6H,1H3,(H,12,13);1-5H |
| InChIKey | KPRLFLKBBYOPMN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-fluorobenzaldehyde;3-(4-fluorophenyl)-2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorobenzaldehyde;3-(4-fluorophenyl)-2-methylprop-2-enoic acid?
The IUPAC name of 4-fluorobenzaldehyde;3-(4-fluorophenyl)-2-methylprop-2-enoic acid (CID 159204345) is 4-fluorobenzaldehyde;3-(4-fluorophenyl)-2-methylprop-2-enoic acid.
What is the SMILES notation for 4-fluorobenzaldehyde;3-(4-fluorophenyl)-2-methylprop-2-enoic acid?
The canonical SMILES for 4-fluorobenzaldehyde;3-(4-fluorophenyl)-2-methylprop-2-enoic acid is CC(=Cc1ccc(F)cc1)C(=O)O.O=Cc1ccc(F)cc1.
What is the InChIKey of 4-fluorobenzaldehyde;3-(4-fluorophenyl)-2-methylprop-2-enoic acid?
The InChIKey is KPRLFLKBBYOPMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FO2.C7H5FO/c1-7(10(12)13)6-8-2-4-9(11)5-3-8;8-7-3-1-6(5-9)2-4-7/h2-6H,1H3,(H,12,13);1-5H.
What are the key properties of 4-fluorobenzaldehyde;3-(4-fluorophenyl)-2-methylprop-2-enoic acid?
4-fluorobenzaldehyde;3-(4-fluorophenyl)-2-methylprop-2-enoic acid has a molecular weight of 304.29 g/mol, XLogP of 3.95, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorobenzaldehyde;3-(4-fluorophenyl)-2-methylprop-2-enoic acid is sourced from PubChem (CID 159204345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).