C38H44N2O4 — CID 159204516
2-[3-[(E)-5-(1,3-dioxolan-2-yl)pent-1-enyl]phenyl]pyridine;2-[3-[5-(1,3-dioxolan-2-yl)pentyl]phenyl]pyridine (PubChem CID 159204516) has the molecular formula C38H44N2O4 and a molecular weight of 592.78 g/mol. Its IUPAC name is 2-[3-[(E)-5-(1,3-dioxolan-2-yl)pent-1-enyl]phenyl]pyridine;2-[3-[5-(1,3-dioxolan-2-yl)pentyl]phenyl]pyridine.
| Compound Name | 2-[3-[(E)-5-(1,3-dioxolan-2-yl)pent-1-enyl]phenyl]pyridine;2-[3-[5-(1,3-dioxolan-2-yl)pentyl]phenyl]pyridine |
|---|---|
| PubChem CID | 159204516 |
| Molecular Formula | C38H44N2O4 |
| Molecular Weight | 592.78 g/mol |
| Exact Mass | 592.33 |
| IUPAC Name | 2-[3-[(E)-5-(1,3-dioxolan-2-yl)pent-1-enyl]phenyl]pyridine;2-[3-[5-(1,3-dioxolan-2-yl)pentyl]phenyl]pyridine |
| SMILES | C(=C/c1cccc(-c2ccccn2)c1)\CCCC1OCCO1.c1ccc(-c2cccc(CCCCCC3OCCO3)c2)nc1 |
| InChI | InChI=1S/C19H23NO2.C19H21NO2/c2*1(3-11-19-21-13-14-22-19)2-7-16-8-6-9-17(15-16)18-10-4-5-12-20-18/h4-6,8-10,12,15,19H,1-3,7,11,13-14H2;2,4-10,12,15,19H,1,3,11,13-14H2/b;7-2+ |
| InChIKey | KPSAOMVUNKHAHU-IVYAOGHWSA-N |
| XLogP | 8.53 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.78 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|