C31H37N5O4 — CID 159204737
2-(5-tert-butyl-1H-pyrazol-3-yl)pyridine;4,4-dimethyl-1-pyridin-2-ylpentane-1,3-dione;methyl pyridine-2-carboxylate (PubChem CID 159204737) has the molecular formula C31H37N5O4 and a molecular weight of 543.67 g/mol. Its IUPAC name is 2-(5-tert-butyl-1H-pyrazol-3-yl)pyridine;4,4-dimethyl-1-pyridin-2-ylpentane-1,3-dione;methyl pyridine-2-carboxylate.
| Compound Name | 2-(5-tert-butyl-1H-pyrazol-3-yl)pyridine;4,4-dimethyl-1-pyridin-2-ylpentane-1,3-dione;methyl pyridine-2-carboxylate |
|---|---|
| PubChem CID | 159204737 |
| Molecular Formula | C31H37N5O4 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | 2-(5-tert-butyl-1H-pyrazol-3-yl)pyridine;4,4-dimethyl-1-pyridin-2-ylpentane-1,3-dione;methyl pyridine-2-carboxylate |
| SMILES | CC(C)(C)C(=O)CC(=O)c1ccccn1.CC(C)(C)c1cc(-c2ccccn2)n[nH]1.COC(=O)c1ccccn1 |
| InChI | InChI=1S/C12H15N3.C12H15NO2.C7H7NO2/c1-12(2,3)11-8-10(14-15-11)9-6-4-5-7-13-9;1-12(2,3)11(15)8-10(14)9-6-4-5-7-13-9;1-10-7(9)6-4-2-3-5-8-6/h4-8H,1-3H3,(H,14,15);4-7H,8H2,1-3H3;2-5H,1H3 |
| InChIKey | KPSSKPOVHRXWFB-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 127.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|