About 1-(4-methyl-5-piperazin-1-yl-1-benzofuran-2-yl)ethanone;2,2,2-trifluoroacetaldehyde
1-(4-methyl-5-piperazin-1-yl-1-benzofuran-2-yl)ethanone;2,2,2-trifluoroacetaldehyde (PubChem CID 159205067) has the molecular formula C17H19F3N2O3
and a molecular weight of 356.34 g/mol. Its IUPAC name is 1-(4-methyl-5-piperazin-1-yl-1-benzofuran-2-yl)ethanone;2,2,2-trifluoroacetaldehyde.
Molecular Properties
| Compound Name | 1-(4-methyl-5-piperazin-1-yl-1-benzofuran-2-yl)ethanone;2,2,2-trifluoroacetaldehyde |
| PubChem CID | 159205067 |
| Molecular Formula | C17H19F3N2O3 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 1-(4-methyl-5-piperazin-1-yl-1-benzofuran-2-yl)ethanone;2,2,2-trifluoroacetaldehyde |
| SMILES | CC(=O)c1cc2c(C)c(N3CCNCC3)ccc2o1.O=CC(F)(F)F |
| InChI | InChI=1S/C15H18N2O2.C2HF3O/c1-10-12-9-15(11(2)18)19-14(12)4-3-13(10)17-7-5-16-6-8-17;3-2(4,5)1-6/h3-4,9,16H,5-8H2,1-2H3;1H |
| InChIKey | KPTVJVDIRZXWKW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methyl-5-piperazin-1-yl-1-benzofuran-2-yl)ethanone;2,2,2-trifluoroacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methyl-5-piperazin-1-yl-1-benzofuran-2-yl)ethanone;2,2,2-trifluoroacetaldehyde?
The IUPAC name of 1-(4-methyl-5-piperazin-1-yl-1-benzofuran-2-yl)ethanone;2,2,2-trifluoroacetaldehyde (CID 159205067) is 1-(4-methyl-5-piperazin-1-yl-1-benzofuran-2-yl)ethanone;2,2,2-trifluoroacetaldehyde.
What is the SMILES notation for 1-(4-methyl-5-piperazin-1-yl-1-benzofuran-2-yl)ethanone;2,2,2-trifluoroacetaldehyde?
The canonical SMILES for 1-(4-methyl-5-piperazin-1-yl-1-benzofuran-2-yl)ethanone;2,2,2-trifluoroacetaldehyde is CC(=O)c1cc2c(C)c(N3CCNCC3)ccc2o1.O=CC(F)(F)F.
What is the InChIKey of 1-(4-methyl-5-piperazin-1-yl-1-benzofuran-2-yl)ethanone;2,2,2-trifluoroacetaldehyde?
The InChIKey is KPTVJVDIRZXWKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2.C2HF3O/c1-10-12-9-15(11(2)18)19-14(12)4-3-13(10)17-7-5-16-6-8-17;3-2(4,5)1-6/h3-4,9,16H,5-8H2,1-2H3;1H.
What are the key properties of 1-(4-methyl-5-piperazin-1-yl-1-benzofuran-2-yl)ethanone;2,2,2-trifluoroacetaldehyde?
1-(4-methyl-5-piperazin-1-yl-1-benzofuran-2-yl)ethanone;2,2,2-trifluoroacetaldehyde has a molecular weight of 356.34 g/mol, XLogP of 3.10, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methyl-5-piperazin-1-yl-1-benzofuran-2-yl)ethanone;2,2,2-trifluoroacetaldehyde is sourced from PubChem (CID 159205067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).