C40H37ClN2O6 — CID 159205811
ethyl 2-[2-chloro-4-(3-methoxyphenyl)quinolin-3-yl]acetate;ethyl 2-[4-(3-methoxyphenyl)quinolin-3-yl]acetate (PubChem CID 159205811) has the molecular formula C40H37ClN2O6 and a molecular weight of 677.20 g/mol. Its IUPAC name is ethyl 2-[2-chloro-4-(3-methoxyphenyl)quinolin-3-yl]acetate;ethyl 2-[4-(3-methoxyphenyl)quinolin-3-yl]acetate.
| Compound Name | ethyl 2-[2-chloro-4-(3-methoxyphenyl)quinolin-3-yl]acetate;ethyl 2-[4-(3-methoxyphenyl)quinolin-3-yl]acetate |
|---|---|
| PubChem CID | 159205811 |
| Molecular Formula | C40H37ClN2O6 |
| Molecular Weight | 677.20 g/mol |
| Exact Mass | 676.23 |
| IUPAC Name | ethyl 2-[2-chloro-4-(3-methoxyphenyl)quinolin-3-yl]acetate;ethyl 2-[4-(3-methoxyphenyl)quinolin-3-yl]acetate |
| SMILES | CCOC(=O)Cc1c(Cl)nc2ccccc2c1-c1cccc(OC)c1.CCOC(=O)Cc1cnc2ccccc2c1-c1cccc(OC)c1 |
| InChI | InChI=1S/C20H18ClNO3.C20H19NO3/c1-3-25-18(23)12-16-19(13-7-6-8-14(11-13)24-2)15-9-4-5-10-17(15)22-20(16)21;1-3-24-19(22)12-15-13-21-18-10-5-4-9-17(18)20(15)14-7-6-8-16(11-14)23-2/h4-11H,3,12H2,1-2H3;4-11,13H,3,12H2,1-2H3 |
| InChIKey | KPWFUFGJNGSSLO-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 96.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.20 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|