C27H34N4O6S2 — CID 159206548
5-(N-[(3-amino-3-oxopropanoyl)amino]anilino)-5-sulfanylidenepentanoic acid;7-anilino-7-sulfanylideneheptanoic acid (PubChem CID 159206548) has the molecular formula C27H34N4O6S2 and a molecular weight of 574.73 g/mol. Its IUPAC name is 5-(N-[(3-amino-3-oxopropanoyl)amino]anilino)-5-sulfanylidenepentanoic acid;7-anilino-7-sulfanylideneheptanoic acid.
| Compound Name | 5-(N-[(3-amino-3-oxopropanoyl)amino]anilino)-5-sulfanylidenepentanoic acid;7-anilino-7-sulfanylideneheptanoic acid |
|---|---|
| PubChem CID | 159206548 |
| Molecular Formula | C27H34N4O6S2 |
| Molecular Weight | 574.73 g/mol |
| Exact Mass | 574.19 |
| IUPAC Name | 5-(N-[(3-amino-3-oxopropanoyl)amino]anilino)-5-sulfanylidenepentanoic acid;7-anilino-7-sulfanylideneheptanoic acid |
| SMILES | NC(=O)CC(=O)NN(C(=S)CCCC(=O)O)c1ccccc1.O=C(O)CCCCCC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C14H17N3O4S.C13H17NO2S/c15-11(18)9-12(19)16-17(10-5-2-1-3-6-10)13(22)7-4-8-14(20)21;15-13(16)10-6-2-5-9-12(17)14-11-7-3-1-4-8-11/h1-3,5-6H,4,7-9H2,(H2,15,18)(H,16,19)(H,20,21);1,3-4,7-8H,2,5-6,9-10H2,(H,14,17)(H,15,16) |
| InChIKey | KPYNEDAHJOKIFW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 162.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.73 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|