C29H51FO7 — CID 159207268
[(2R,4S,5S)-6-ethyl-2-[(2R,4S,5S)-6-ethyl-2-[(2R,4S,5S)-6-ethyl-2-fluoro-4,5-dimethyloxan-3-yl]oxy-4,5-dimethyloxan-3-yl]oxy-4,5-dimethyloxan-3-yl] acetate (PubChem CID 159207268) has the molecular formula C29H51FO7 and a molecular weight of 530.72 g/mol. Its IUPAC name is [(2R,4S,5S)-6-ethyl-2-[(2R,4S,5S)-6-ethyl-2-[(2R,4S,5S)-6-ethyl-2-fluoro-4,5-dimethyloxan-3-yl]oxy-4,5-dimethyloxan-3-yl]oxy-4,5-dimethyloxan-3-yl] acetate.
| Compound Name | [(2R,4S,5S)-6-ethyl-2-[(2R,4S,5S)-6-ethyl-2-[(2R,4S,5S)-6-ethyl-2-fluoro-4,5-dimethyloxan-3-yl]oxy-4,5-dimethyloxan-3-yl]oxy-4,5-dimethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 159207268 |
| Molecular Formula | C29H51FO7 |
| Molecular Weight | 530.72 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | [(2R,4S,5S)-6-ethyl-2-[(2R,4S,5S)-6-ethyl-2-[(2R,4S,5S)-6-ethyl-2-fluoro-4,5-dimethyloxan-3-yl]oxy-4,5-dimethyloxan-3-yl]oxy-4,5-dimethyloxan-3-yl] acetate |
| SMILES | CCC1O[C@H](OC2[C@@H](OC3[C@@H](C)[C@H](C)C(CC)O[C@@H]3F)OC(CC)[C@@H](C)[C@@H]2C)C(OC(C)=O)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C29H51FO7/c1-11-21-14(4)17(7)24(27(30)33-21)36-29-26(19(9)16(6)23(13-3)35-29)37-28-25(32-20(10)31)18(8)15(5)22(12-2)34-28/h14-19,21-29H,11-13H2,1-10H3/t14-,15-,16-,17-,18-,19-,21?,22?,23?,24?,25?,26?,27-,28+,29+/m0/s1 |
| InChIKey | KQAQEDJWABESSR-AKPPHXCHSA-N |
| XLogP | 5.88 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.72 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |