C32H35F3N4O6 — CID 159208926
2-(1-benzyl-6-nitroindol-3-yl)-1,1,1-trifluoro-3-spiro[2H-[1,4]dioxino[2,3-b]pyridine-3,4'-piperidine]-1'-ylpropan-2-ol;propan-2-ol (PubChem CID 159208926) has the molecular formula C32H35F3N4O6 and a molecular weight of 628.65 g/mol. Its IUPAC name is 2-(1-benzyl-6-nitroindol-3-yl)-1,1,1-trifluoro-3-spiro[2H-[1,4]dioxino[2,3-b]pyridine-3,4'-piperidine]-1'-ylpropan-2-ol;propan-2-ol.
| Compound Name | 2-(1-benzyl-6-nitroindol-3-yl)-1,1,1-trifluoro-3-spiro[2H-[1,4]dioxino[2,3-b]pyridine-3,4'-piperidine]-1'-ylpropan-2-ol;propan-2-ol |
|---|---|
| PubChem CID | 159208926 |
| Molecular Formula | C32H35F3N4O6 |
| Molecular Weight | 628.65 g/mol |
| Exact Mass | 628.25 |
| IUPAC Name | 2-(1-benzyl-6-nitroindol-3-yl)-1,1,1-trifluoro-3-spiro[2H-[1,4]dioxino[2,3-b]pyridine-3,4'-piperidine]-1'-ylpropan-2-ol;propan-2-ol |
| SMILES | CC(C)O.O=[N+]([O-])c1ccc2c(C(O)(CN3CCC4(CC3)COc3cccnc3O4)C(F)(F)F)cn(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C29H27F3N4O5.C3H8O/c30-29(31,32)28(37,18-34-13-10-27(11-14-34)19-40-25-7-4-12-33-26(25)41-27)23-17-35(16-20-5-2-1-3-6-20)24-15-21(36(38)39)8-9-22(23)24;1-3(2)4/h1-9,12,15,17,37H,10-11,13-14,16,18-19H2;3-4H,1-2H3 |
| InChIKey | KQFXBVPJVJFSDY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 123.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.65 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|