C28H34F6O8Si — CID 159208931
ethenyl(triethoxy)silane;1,1,2,4,4,4-hexafluorobutyl 2-methylprop-2-enoate;3-(2-phenylethenyl)furan-2,5-dione (PubChem CID 159208931) has the molecular formula C28H34F6O8Si and a molecular weight of 640.65 g/mol. Its IUPAC name is ethenyl(triethoxy)silane;1,1,2,4,4,4-hexafluorobutyl 2-methylprop-2-enoate;3-(2-phenylethenyl)furan-2,5-dione.
| Compound Name | ethenyl(triethoxy)silane;1,1,2,4,4,4-hexafluorobutyl 2-methylprop-2-enoate;3-(2-phenylethenyl)furan-2,5-dione |
|---|---|
| PubChem CID | 159208931 |
| Molecular Formula | C28H34F6O8Si |
| Molecular Weight | 640.65 g/mol |
| Exact Mass | 640.19 |
| IUPAC Name | ethenyl(triethoxy)silane;1,1,2,4,4,4-hexafluorobutyl 2-methylprop-2-enoate;3-(2-phenylethenyl)furan-2,5-dione |
| SMILES | C=C(C)C(=O)OC(F)(F)C(F)CC(F)(F)F.C=C[Si](OCC)(OCC)OCC.O=C1C=C(C=Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C12H8O3.C8H8F6O2.C8H18O3Si/c13-11-8-10(12(14)15-11)7-6-9-4-2-1-3-5-9;1-4(2)6(15)16-8(13,14)5(9)3-7(10,11)12;1-5-9-12(8-4,10-6-2)11-7-3/h1-8H;5H,1,3H2,2H3;8H,4-7H2,1-3H3 |
| InChIKey | KQFXGTINRPYYDG-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.65 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|