(E)-dec-4-enoyl chloride

C10H17ClO — CID 15920950

IUPAC(E)-dec-4-enoyl chloride
SMILESCCCCC/C=C/CCC(=O)Cl
InChIInChI=1S/C10H17ClO/c1-2-3-4-5-6-7-8-9-10(11)12/h6-7H,2-5,8-9H2,1H3/b7-6+
InChIKeyDTDAQKBYLHFDRS-VOTSOKGWSA-N
MW188.70 g/mol
LogP3.67
Rot. Bonds7

About (E)-dec-4-enoyl chloride

(E)-dec-4-enoyl chloride (PubChem CID 15920950) has the molecular formula C10H17ClO and a molecular weight of 188.70 g/mol. Its IUPAC name is (E)-dec-4-enoyl chloride.

Molecular Properties

Compound Name(E)-dec-4-enoyl chloride
PubChem CID15920950
Molecular FormulaC10H17ClO
Molecular Weight188.70 g/mol
Exact Mass188.10
IUPAC Name(E)-dec-4-enoyl chloride
SMILESCCCCC/C=C/CCC(=O)Cl
InChIInChI=1S/C10H17ClO/c1-2-3-4-5-6-7-8-9-10(11)12/h6-7H,2-5,8-9H2,1H3/b7-6+
InChIKeyDTDAQKBYLHFDRS-VOTSOKGWSA-N
XLogP3.67
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds7
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.70
LogP ≤ 53.67
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (E)-dec-4-enoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-dec-4-enoyl chloride?
The IUPAC name of (E)-dec-4-enoyl chloride (CID 15920950) is (E)-dec-4-enoyl chloride.
What is the SMILES notation for (E)-dec-4-enoyl chloride?
The canonical SMILES for (E)-dec-4-enoyl chloride is CCCCC/C=C/CCC(=O)Cl.
What is the InChIKey of (E)-dec-4-enoyl chloride?
The InChIKey is DTDAQKBYLHFDRS-VOTSOKGWSA-N. The full InChI is InChI=1S/C10H17ClO/c1-2-3-4-5-6-7-8-9-10(11)12/h6-7H,2-5,8-9H2,1H3/b7-6+.
What are the key properties of (E)-dec-4-enoyl chloride?
(E)-dec-4-enoyl chloride has a molecular weight of 188.70 g/mol, XLogP of 3.67, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-dec-4-enoyl chloride is sourced from PubChem (CID 15920950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).