C4H14N4 — CID 159210195
1,2-dimethylguanidine;methanamine (PubChem CID 159210195) has the molecular formula C4H14N4 and a molecular weight of 118.18 g/mol. Its IUPAC name is 1,2-dimethylguanidine;methanamine.
| Compound Name | 1,2-dimethylguanidine;methanamine |
|---|---|
| PubChem CID | 159210195 |
| Molecular Formula | C4H14N4 |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.12 |
| IUPAC Name | 1,2-dimethylguanidine;methanamine |
| SMILES | C/N=C(\N)NC.CN |
| InChI | InChI=1S/C3H9N3.CH5N/c1-5-3(4)6-2;1-2/h1-2H3,(H3,4,5,6);2H2,1H3 |
| InChIKey | KQKAGQCEQNUJNX-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|