About 2,4-dimethyl-N,N-di(propan-2-yl)pent-2-en-3-amine;methane
2,4-dimethyl-N,N-di(propan-2-yl)pent-2-en-3-amine;methane (PubChem CID 159210280) has the molecular formula C14H31N
and a molecular weight of 213.41 g/mol. Its IUPAC name is 2,4-dimethyl-N,N-di(propan-2-yl)pent-2-en-3-amine;methane.
Molecular Properties
| Compound Name | 2,4-dimethyl-N,N-di(propan-2-yl)pent-2-en-3-amine;methane |
| PubChem CID | 159210280 |
| Molecular Formula | C14H31N |
| Molecular Weight | 213.41 g/mol |
| Exact Mass | 213.25 |
| IUPAC Name | 2,4-dimethyl-N,N-di(propan-2-yl)pent-2-en-3-amine;methane |
| SMILES | C.CC(C)=C(C(C)C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C13H27N.CH4/c1-9(2)13(10(3)4)14(11(5)6)12(7)8;/h9,11-12H,1-8H3;1H4 |
| InChIKey | KQKGXHYZUPERTL-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-dimethyl-N,N-di(propan-2-yl)pent-2-en-3-amine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-N,N-di(propan-2-yl)pent-2-en-3-amine;methane?
The IUPAC name of 2,4-dimethyl-N,N-di(propan-2-yl)pent-2-en-3-amine;methane (CID 159210280) is 2,4-dimethyl-N,N-di(propan-2-yl)pent-2-en-3-amine;methane.
What is the SMILES notation for 2,4-dimethyl-N,N-di(propan-2-yl)pent-2-en-3-amine;methane?
The canonical SMILES for 2,4-dimethyl-N,N-di(propan-2-yl)pent-2-en-3-amine;methane is C.CC(C)=C(C(C)C)N(C(C)C)C(C)C.
What is the InChIKey of 2,4-dimethyl-N,N-di(propan-2-yl)pent-2-en-3-amine;methane?
The InChIKey is KQKGXHYZUPERTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N.CH4/c1-9(2)13(10(3)4)14(11(5)6)12(7)8;/h9,11-12H,1-8H3;1H4.
What are the key properties of 2,4-dimethyl-N,N-di(propan-2-yl)pent-2-en-3-amine;methane?
2,4-dimethyl-N,N-di(propan-2-yl)pent-2-en-3-amine;methane has a molecular weight of 213.41 g/mol, XLogP of 4.69, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-N,N-di(propan-2-yl)pent-2-en-3-amine;methane is sourced from PubChem (CID 159210280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).