C35H48N2O2+2 — CID 159210588
4,6-ditert-butyl-23-methyl-21-pentyl-2,25-dioxa-10,17-diazoniahexacyclo[15.8.0.01,10.03,8.011,16.019,24]pentacosa-3(8),4,6,9,17,19(24),20,22-octaene (PubChem CID 159210588) has the molecular formula C35H48N2O2+2 and a molecular weight of 528.78 g/mol. Its IUPAC name is 4,6-ditert-butyl-23-methyl-21-pentyl-2,25-dioxa-10,17-diazoniahexacyclo[15.8.0.01,10.03,8.011,16.019,24]pentacosa-3(8),4,6,9,17,19(24),20,22-octaene.
| Compound Name | 4,6-ditert-butyl-23-methyl-21-pentyl-2,25-dioxa-10,17-diazoniahexacyclo[15.8.0.01,10.03,8.011,16.019,24]pentacosa-3(8),4,6,9,17,19(24),20,22-octaene |
|---|---|
| PubChem CID | 159210588 |
| Molecular Formula | C35H48N2O2+2 |
| Molecular Weight | 528.78 g/mol |
| Exact Mass | 528.37 |
| IUPAC Name | 4,6-ditert-butyl-23-methyl-21-pentyl-2,25-dioxa-10,17-diazoniahexacyclo[15.8.0.01,10.03,8.011,16.019,24]pentacosa-3(8),4,6,9,17,19(24),20,22-octaene |
| SMILES | CCCCCc1cc(C)c2c(c1)C=[N+]1C3CCCCC3[N+]3=Cc4cc(C(C)(C)C)cc(C(C)(C)C)c4OC13O2 |
| InChI | InChI=1S/C35H48N2O2/c1-9-10-11-14-24-17-23(2)31-25(18-24)21-36-29-15-12-13-16-30(29)37-22-26-19-27(33(3,4)5)20-28(34(6,7)8)32(26)39-35(36,37)38-31/h17-22,29-30H,9-16H2,1-8H3/q+2 |
| InChIKey | MRNHROQCPFHLKH-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 24.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.78 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|