About (3-chloro-2-cyclopenta-2,4-dien-1-ylphenyl)-diphenylphosphane;bis(nickel(2+))
(3-chloro-2-cyclopenta-2,4-dien-1-ylphenyl)-diphenylphosphane;bis(nickel(2+)) (PubChem CID 159210730) has the molecular formula C23H18ClNi2P+4
and a molecular weight of 478.21 g/mol. Its IUPAC name is (3-chloro-2-cyclopenta-2,4-dien-1-ylphenyl)-diphenylphosphane;bis(nickel(2+)).
Molecular Properties
| Compound Name | (3-chloro-2-cyclopenta-2,4-dien-1-ylphenyl)-diphenylphosphane;bis(nickel(2+)) |
| PubChem CID | 159210730 |
| Molecular Formula | C23H18ClNi2P+4 |
| Molecular Weight | 478.21 g/mol |
| Exact Mass | 475.95 |
| IUPAC Name | (3-chloro-2-cyclopenta-2,4-dien-1-ylphenyl)-diphenylphosphane;bis(nickel(2+)) |
| SMILES | Clc1cccc(P(c2ccccc2)c2ccccc2)c1C1C=CC=C1.[Ni+2].[Ni+2] |
| InChI | InChI=1S/C23H18ClP.2Ni/c24-21-16-9-17-22(23(21)18-10-7-8-11-18)25(19-12-3-1-4-13-19)20-14-5-2-6-15-20;;/h1-18H;;/q;2*+2 |
| InChIKey | KQLQNIUMVVAWJO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.21 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3-chloro-2-cyclopenta-2,4-dien-1-ylphenyl)-diphenylphosphane;bis(nickel(2+)) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chloro-2-cyclopenta-2,4-dien-1-ylphenyl)-diphenylphosphane;bis(nickel(2+))?
The IUPAC name of (3-chloro-2-cyclopenta-2,4-dien-1-ylphenyl)-diphenylphosphane;bis(nickel(2+)) (CID 159210730) is (3-chloro-2-cyclopenta-2,4-dien-1-ylphenyl)-diphenylphosphane;bis(nickel(2+)).
What is the SMILES notation for (3-chloro-2-cyclopenta-2,4-dien-1-ylphenyl)-diphenylphosphane;bis(nickel(2+))?
The canonical SMILES for (3-chloro-2-cyclopenta-2,4-dien-1-ylphenyl)-diphenylphosphane;bis(nickel(2+)) is Clc1cccc(P(c2ccccc2)c2ccccc2)c1C1C=CC=C1.[Ni+2].[Ni+2].
What is the InChIKey of (3-chloro-2-cyclopenta-2,4-dien-1-ylphenyl)-diphenylphosphane;bis(nickel(2+))?
The InChIKey is KQLQNIUMVVAWJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18ClP.2Ni/c24-21-16-9-17-22(23(21)18-10-7-8-11-18)25(19-12-3-1-4-13-19)20-14-5-2-6-15-20;;/h1-18H;;/q;2*+2.
What are the key properties of (3-chloro-2-cyclopenta-2,4-dien-1-ylphenyl)-diphenylphosphane;bis(nickel(2+))?
(3-chloro-2-cyclopenta-2,4-dien-1-ylphenyl)-diphenylphosphane;bis(nickel(2+)) has a molecular weight of 478.21 g/mol, XLogP of 5.30, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chloro-2-cyclopenta-2,4-dien-1-ylphenyl)-diphenylphosphane;bis(nickel(2+)) is sourced from PubChem (CID 159210730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).