C32H38N4O2 — CID 159210981
N-[(2S)-5-[[(1R,2S)-2-(4-methylphenyl)cyclopropyl]amino]-1-oxo-1-piperidin-1-ylpentan-2-yl]-4-pyridin-2-ylbenzamide (PubChem CID 159210981) has the molecular formula C32H38N4O2 and a molecular weight of 510.68 g/mol. Its IUPAC name is N-[(2S)-5-[[(1R,2S)-2-(4-methylphenyl)cyclopropyl]amino]-1-oxo-1-piperidin-1-ylpentan-2-yl]-4-pyridin-2-ylbenzamide.
| Compound Name | N-[(2S)-5-[[(1R,2S)-2-(4-methylphenyl)cyclopropyl]amino]-1-oxo-1-piperidin-1-ylpentan-2-yl]-4-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 159210981 |
| Molecular Formula | C32H38N4O2 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | N-[(2S)-5-[[(1R,2S)-2-(4-methylphenyl)cyclopropyl]amino]-1-oxo-1-piperidin-1-ylpentan-2-yl]-4-pyridin-2-ylbenzamide |
| SMILES | Cc1ccc([C@@H]2C[C@H]2NCCC[C@H](NC(=O)c2ccc(-c3ccccn3)cc2)C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C32H38N4O2/c1-23-10-12-24(13-11-23)27-22-30(27)34-19-7-9-29(32(38)36-20-5-2-6-21-36)35-31(37)26-16-14-25(15-17-26)28-8-3-4-18-33-28/h3-4,8,10-18,27,29-30,34H,2,5-7,9,19-22H2,1H3,(H,35,37)/t27-,29-,30+/m0/s1 |
| InChIKey | HOLNNAXMWHMIJX-LOAGWBBBSA-N |
| XLogP | 5.09 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|