C14H29NO2 — CID 159211254
but-2-yne;ethane;5-ethyl-3-methyl-1,3-oxazolidin-2-one (PubChem CID 159211254) has the molecular formula C14H29NO2 and a molecular weight of 243.39 g/mol. Its IUPAC name is but-2-yne;ethane;5-ethyl-3-methyl-1,3-oxazolidin-2-one.
| Compound Name | but-2-yne;ethane;5-ethyl-3-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 159211254 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | but-2-yne;ethane;5-ethyl-3-methyl-1,3-oxazolidin-2-one |
| SMILES | CC.CC.CC#CC.CCC1CN(C)C(=O)O1 |
| InChI | InChI=1S/C6H11NO2.C4H6.2C2H6/c1-3-5-4-7(2)6(8)9-5;1-3-4-2;2*1-2/h5H,3-4H2,1-2H3;1-2H3;2*1-2H3 |
| InChIKey | KQNDBPORUCUIKS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|