C22H16N4Zn — CID 159211349
2-ethynyl-21,22,23,24-tetrahydroporphyrin;zinc (PubChem CID 159211349) has the molecular formula C22H16N4Zn and a molecular weight of 401.79 g/mol. Its IUPAC name is 2-ethynyl-21,22,23,24-tetrahydroporphyrin;zinc.
| Compound Name | 2-ethynyl-21,22,23,24-tetrahydroporphyrin;zinc |
|---|---|
| PubChem CID | 159211349 |
| Molecular Formula | C22H16N4Zn |
| Molecular Weight | 401.79 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 2-ethynyl-21,22,23,24-tetrahydroporphyrin;zinc |
| SMILES | C#Cc1cc2[nH]c1=Cc1ccc([nH]1)C=c1ccc([nH]1)=Cc1ccc([nH]1)C=2.[Zn] |
| InChI | InChI=1S/C22H16N4.Zn/c1-2-14-9-21-12-19-6-5-17(24-19)10-15-3-4-16(23-15)11-18-7-8-20(25-18)13-22(14)26-21;/h1,3-13,23-26H; |
| InChIKey | VGCWFUNWFYLXPU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.79 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|