About [4-[4-(6-cyano-2-pyridinyl)piperazin-1-yl]phenyl]-oxoazanium hydroxide
[4-[4-(6-cyano-2-pyridinyl)piperazin-1-yl]phenyl]-oxoazanium hydroxide (PubChem CID 159211681) has the molecular formula C16H17N5O2
and a molecular weight of 311.35 g/mol. Its IUPAC name is [4-[4-(6-cyano-2-pyridinyl)piperazin-1-yl]phenyl]-oxoazanium hydroxide.
Molecular Properties
| Compound Name | [4-[4-(6-cyano-2-pyridinyl)piperazin-1-yl]phenyl]-oxoazanium hydroxide |
| PubChem CID | 159211681 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | [4-[4-(6-cyano-2-pyridinyl)piperazin-1-yl]phenyl]-oxoazanium hydroxide |
| SMILES | N#Cc1cccc(N2CCN(c3ccc([NH+]=O)cc3)CC2)n1.[OH-] |
| InChI | InChI=1S/C16H15N5O.H2O/c17-12-14-2-1-3-16(18-14)21-10-8-20(9-11-21)15-6-4-13(19-22)5-7-15;/h1-7H,8-11H2;1H2 |
| InChIKey | LBSMGFMCBIHGAT-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 104.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze [4-[4-(6-cyano-2-pyridinyl)piperazin-1-yl]phenyl]-oxoazanium hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(6-cyano-2-pyridinyl)piperazin-1-yl]phenyl]-oxoazanium hydroxide?
The IUPAC name of [4-[4-(6-cyano-2-pyridinyl)piperazin-1-yl]phenyl]-oxoazanium hydroxide (CID 159211681) is [4-[4-(6-cyano-2-pyridinyl)piperazin-1-yl]phenyl]-oxoazanium hydroxide.
What is the SMILES notation for [4-[4-(6-cyano-2-pyridinyl)piperazin-1-yl]phenyl]-oxoazanium hydroxide?
The canonical SMILES for [4-[4-(6-cyano-2-pyridinyl)piperazin-1-yl]phenyl]-oxoazanium hydroxide is N#Cc1cccc(N2CCN(c3ccc([NH+]=O)cc3)CC2)n1.[OH-].
What is the InChIKey of [4-[4-(6-cyano-2-pyridinyl)piperazin-1-yl]phenyl]-oxoazanium hydroxide?
The InChIKey is LBSMGFMCBIHGAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N5O.H2O/c17-12-14-2-1-3-16(18-14)21-10-8-20(9-11-21)15-6-4-13(19-22)5-7-15;/h1-7H,8-11H2;1H2.
What are the key properties of [4-[4-(6-cyano-2-pyridinyl)piperazin-1-yl]phenyl]-oxoazanium hydroxide?
[4-[4-(6-cyano-2-pyridinyl)piperazin-1-yl]phenyl]-oxoazanium hydroxide has a molecular weight of 311.35 g/mol, XLogP of 0.58, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(6-cyano-2-pyridinyl)piperazin-1-yl]phenyl]-oxoazanium hydroxide is sourced from PubChem (CID 159211681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).