C24H28ClN3O — CID 15921305
10-methoxy-7-methyl-2-(2-piperidin-1-ylethyl)pyrido[4,3-c]carbazol-2-ium chloride (PubChem CID 15921305) has the molecular formula C24H28ClN3O and a molecular weight of 409.96 g/mol. Its IUPAC name is 10-methoxy-7-methyl-2-(2-piperidin-1-ylethyl)pyrido[4,3-c]carbazol-2-ium chloride.
| Compound Name | 10-methoxy-7-methyl-2-(2-piperidin-1-ylethyl)pyrido[4,3-c]carbazol-2-ium chloride |
|---|---|
| PubChem CID | 15921305 |
| Molecular Formula | C24H28ClN3O |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 10-methoxy-7-methyl-2-(2-piperidin-1-ylethyl)pyrido[4,3-c]carbazol-2-ium chloride |
| SMILES | COc1ccc2c(c1)c1c3c[n+](CCN4CCCCC4)ccc3ccc1n2C.[Cl-] |
| InChI | InChI=1S/C24H28N3O.ClH/c1-25-22-9-7-19(28-2)16-20(22)24-21-17-27(13-10-18(21)6-8-23(24)25)15-14-26-11-4-3-5-12-26;/h6-10,13,16-17H,3-5,11-12,14-15H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | IFCNKRKQWOKDGF-UHFFFAOYSA-M |
| XLogP | 1.27 |
| TPSA | 21.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|